C13H12N2O4S — CID 139074353
N-[(E)-(2,5-dihydroxyphenyl)methylideneamino]benzenesulfonamide (PubChem CID 139074353) has the molecular formula C13H12N2O4S and a molecular weight of 292.32 g/mol. Its IUPAC name is N-[(E)-(2,5-dihydroxyphenyl)methylideneamino]benzenesulfonamide.
| Compound Name | N-[(E)-(2,5-dihydroxyphenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 139074353 |
| Molecular Formula | C13H12N2O4S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | N-[(E)-(2,5-dihydroxyphenyl)methylideneamino]benzenesulfonamide |
| SMILES | O=S(=O)(N/N=C/c1cc(O)ccc1O)c1ccccc1 |
| InChI | InChI=1S/C13H12N2O4S/c16-11-6-7-13(17)10(8-11)9-14-15-20(18,19)12-4-2-1-3-5-12/h1-9,15-17H/b14-9+ |
| InChIKey | YWUOTASXXJQFGL-NTEUORMPSA-N |
| XLogP | 1.41 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|