C23H35N3O — CID 69090171
2-[8-[2-[cyclohexyl(methyl)amino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide (PubChem CID 69090171) has the molecular formula C23H35N3O and a molecular weight of 369.55 g/mol. Its IUPAC name is 2-[8-[2-[cyclohexyl(methyl)amino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide.
| Compound Name | 2-[8-[2-[cyclohexyl(methyl)amino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
|---|---|
| PubChem CID | 69090171 |
| Molecular Formula | C23H35N3O |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.28 |
| IUPAC Name | 2-[8-[2-[cyclohexyl(methyl)amino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
| SMILES | CN(CCN1C2CCC1CC(c1ccccc1C(N)=O)C2)C1CCCCC1 |
| InChI | InChI=1S/C23H35N3O/c1-25(18-7-3-2-4-8-18)13-14-26-19-11-12-20(26)16-17(15-19)21-9-5-6-10-22(21)23(24)27/h5-6,9-10,17-20H,2-4,7-8,11-16H2,1H3,(H2,24,27) |
| InChIKey | GVYCANYYZQYTJL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |