C23H26N2O — CID 69092650
2-hydroxy-3,3,4,4,6-pentamethyl-1-quinolin-3-yl-1H-isoquinoline (PubChem CID 69092650) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-hydroxy-3,3,4,4,6-pentamethyl-1-quinolin-3-yl-1H-isoquinoline.
| Compound Name | 2-hydroxy-3,3,4,4,6-pentamethyl-1-quinolin-3-yl-1H-isoquinoline |
|---|---|
| PubChem CID | 69092650 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-hydroxy-3,3,4,4,6-pentamethyl-1-quinolin-3-yl-1H-isoquinoline |
| SMILES | Cc1ccc2c(c1)C(C)(C)C(C)(C)N(O)C2c1cnc2ccccc2c1 |
| InChI | InChI=1S/C23H26N2O/c1-15-10-11-18-19(12-15)22(2,3)23(4,5)25(26)21(18)17-13-16-8-6-7-9-20(16)24-14-17/h6-14,21,26H,1-5H3 |
| InChIKey | XMWDPUBDFGSFNM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |