C20H23NO2 — CID 69093023
2-phenyl-2-(2-phenylethyl)oxane-4-carboxamide (PubChem CID 69093023) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-phenyl-2-(2-phenylethyl)oxane-4-carboxamide.
| Compound Name | 2-phenyl-2-(2-phenylethyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 69093023 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-phenyl-2-(2-phenylethyl)oxane-4-carboxamide |
| SMILES | NC(=O)C1CCOC(CCc2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C20H23NO2/c21-19(22)17-12-14-23-20(15-17,18-9-5-2-6-10-18)13-11-16-7-3-1-4-8-16/h1-10,17H,11-15H2,(H2,21,22) |
| InChIKey | GIVRJDRQQSFCHN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |