C13H17NO3 — CID 69093922
1,3-oxazolidin-3-yl 4-phenylbutanoate (PubChem CID 69093922) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 1,3-oxazolidin-3-yl 4-phenylbutanoate.
| Compound Name | 1,3-oxazolidin-3-yl 4-phenylbutanoate |
|---|---|
| PubChem CID | 69093922 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1,3-oxazolidin-3-yl 4-phenylbutanoate |
| SMILES | O=C(CCCc1ccccc1)ON1CCOC1 |
| InChI | InChI=1S/C13H17NO3/c15-13(17-14-9-10-16-11-14)8-4-7-12-5-2-1-3-6-12/h1-3,5-6H,4,7-11H2 |
| InChIKey | NNHVOOKEQHLALZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |