About tert-butyl 1-[[(2,4-dichlorobenzoyl)amino]methyl]-4-(6-fluoro-2-pyridinyl)piperidine-4-carboxylate
tert-butyl 1-[[(2,4-dichlorobenzoyl)amino]methyl]-4-(6-fluoro-2-pyridinyl)piperidine-4-carboxylate (PubChem CID 69094291) has the molecular formula C23H26Cl2FN3O3
and a molecular weight of 482.38 g/mol. Its IUPAC name is tert-butyl 1-[[(2,4-dichlorobenzoyl)amino]methyl]-4-(6-fluoro-2-pyridinyl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 1-[[(2,4-dichlorobenzoyl)amino]methyl]-4-(6-fluoro-2-pyridinyl)piperidine-4-carboxylate |
| PubChem CID | 69094291 |
| Molecular Formula | C23H26Cl2FN3O3 |
| Molecular Weight | 482.38 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | tert-butyl 1-[[(2,4-dichlorobenzoyl)amino]methyl]-4-(6-fluoro-2-pyridinyl)piperidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(c2cccc(F)n2)CCN(CNC(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C23H26Cl2FN3O3/c1-22(2,3)32-21(31)23(18-5-4-6-19(26)28-18)9-11-29(12-10-23)14-27-20(30)16-8-7-15(24)13-17(16)25/h4-8,13H,9-12,14H2,1-3H3,(H,27,30) |
| InChIKey | UIDJNSAHJWYSEP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 1-[[(2,4-dichlorobenzoyl)amino]methyl]-4-(6-fluoro-2-pyridinyl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 1-[[(2,4-dichlorobenzoyl)amino]methyl]-4-(6-fluoro-2-pyridinyl)piperidine-4-carboxylate?
The IUPAC name of tert-butyl 1-[[(2,4-dichlorobenzoyl)amino]methyl]-4-(6-fluoro-2-pyridinyl)piperidine-4-carboxylate (CID 69094291) is tert-butyl 1-[[(2,4-dichlorobenzoyl)amino]methyl]-4-(6-fluoro-2-pyridinyl)piperidine-4-carboxylate.
What is the SMILES notation for tert-butyl 1-[[(2,4-dichlorobenzoyl)amino]methyl]-4-(6-fluoro-2-pyridinyl)piperidine-4-carboxylate?
The canonical SMILES for tert-butyl 1-[[(2,4-dichlorobenzoyl)amino]methyl]-4-(6-fluoro-2-pyridinyl)piperidine-4-carboxylate is CC(C)(C)OC(=O)C1(c2cccc(F)n2)CCN(CNC(=O)c2ccc(Cl)cc2Cl)CC1.
What is the InChIKey of tert-butyl 1-[[(2,4-dichlorobenzoyl)amino]methyl]-4-(6-fluoro-2-pyridinyl)piperidine-4-carboxylate?
The InChIKey is UIDJNSAHJWYSEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26Cl2FN3O3/c1-22(2,3)32-21(31)23(18-5-4-6-19(26)28-18)9-11-29(12-10-23)14-27-20(30)16-8-7-15(24)13-17(16)25/h4-8,13H,9-12,14H2,1-3H3,(H,27,30).
What are the key properties of tert-butyl 1-[[(2,4-dichlorobenzoyl)amino]methyl]-4-(6-fluoro-2-pyridinyl)piperidine-4-carboxylate?
tert-butyl 1-[[(2,4-dichlorobenzoyl)amino]methyl]-4-(6-fluoro-2-pyridinyl)piperidine-4-carboxylate has a molecular weight of 482.38 g/mol, XLogP of 4.59, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1-[[(2,4-dichlorobenzoyl)amino]methyl]-4-(6-fluoro-2-pyridinyl)piperidine-4-carboxylate is sourced from PubChem (CID 69094291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).