C22H18FN3O2 — CID 69097172
methyl 6-[(6-fluoro-5-methyl-2-pyridin-3-yl-1H-indol-3-yl)methyl]pyridine-2-carboxylate (PubChem CID 69097172) has the molecular formula C22H18FN3O2 and a molecular weight of 375.40 g/mol. Its IUPAC name is methyl 6-[(6-fluoro-5-methyl-2-pyridin-3-yl-1H-indol-3-yl)methyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[(6-fluoro-5-methyl-2-pyridin-3-yl-1H-indol-3-yl)methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 69097172 |
| Molecular Formula | C22H18FN3O2 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | methyl 6-[(6-fluoro-5-methyl-2-pyridin-3-yl-1H-indol-3-yl)methyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(Cc2c(-c3cccnc3)[nH]c3cc(F)c(C)cc23)n1 |
| InChI | InChI=1S/C22H18FN3O2/c1-13-9-16-17(10-15-6-3-7-19(25-15)22(27)28-2)21(14-5-4-8-24-12-14)26-20(16)11-18(13)23/h3-9,11-12,26H,10H2,1-2H3 |
| InChIKey | NYIURDSNPKNSEW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |