C22H19FN2O3S — CID 69097186
methyl 6-[(6-ethoxy-5-fluoro-2-thiophen-3-yl-1H-indol-3-yl)methyl]pyridine-2-carboxylate (PubChem CID 69097186) has the molecular formula C22H19FN2O3S and a molecular weight of 410.47 g/mol. Its IUPAC name is methyl 6-[(6-ethoxy-5-fluoro-2-thiophen-3-yl-1H-indol-3-yl)methyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[(6-ethoxy-5-fluoro-2-thiophen-3-yl-1H-indol-3-yl)methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 69097186 |
| Molecular Formula | C22H19FN2O3S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | methyl 6-[(6-ethoxy-5-fluoro-2-thiophen-3-yl-1H-indol-3-yl)methyl]pyridine-2-carboxylate |
| SMILES | CCOc1cc2[nH]c(-c3ccsc3)c(Cc3cccc(C(=O)OC)n3)c2cc1F |
| InChI | InChI=1S/C22H19FN2O3S/c1-3-28-20-11-19-15(10-17(20)23)16(21(25-19)13-7-8-29-12-13)9-14-5-4-6-18(24-14)22(26)27-2/h4-8,10-12,25H,3,9H2,1-2H3 |
| InChIKey | OMPMOERVKPEJPP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |