C44H36O4 — CID 69098410
5-(3,7-ditert-butylnaphthalen-1-yl)-3-(9-oxoxanthen-2-yl)xanthen-9-one (PubChem CID 69098410) has the molecular formula C44H36O4 and a molecular weight of 628.77 g/mol. Its IUPAC name is 5-(3,7-ditert-butylnaphthalen-1-yl)-3-(9-oxoxanthen-2-yl)xanthen-9-one.
| Compound Name | 5-(3,7-ditert-butylnaphthalen-1-yl)-3-(9-oxoxanthen-2-yl)xanthen-9-one |
|---|---|
| PubChem CID | 69098410 |
| Molecular Formula | C44H36O4 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 5-(3,7-ditert-butylnaphthalen-1-yl)-3-(9-oxoxanthen-2-yl)xanthen-9-one |
| SMILES | CC(C)(C)c1cc(-c2cccc3c(=O)c4ccc(-c5ccc6oc7ccccc7c(=O)c6c5)cc4oc23)c2cc(C(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C44H36O4/c1-43(2,3)28-17-14-27-20-29(44(4,5)6)24-35(34(27)23-28)30-11-9-12-33-40(45)32-18-15-26(22-39(32)48-42(30)33)25-16-19-38-36(21-25)41(46)31-10-7-8-13-37(31)47-38/h7-24H,1-6H3 |
| InChIKey | STUBCJHCWRXWTC-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|