C23H36N2O3Si — CID 69099372
ethyl 8-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2,3-dimethyl-7-prop-2-enylimidazo[1,2-a]pyridine-6-carboxylate (PubChem CID 69099372) has the molecular formula C23H36N2O3Si and a molecular weight of 416.64 g/mol. Its IUPAC name is ethyl 8-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2,3-dimethyl-7-prop-2-enylimidazo[1,2-a]pyridine-6-carboxylate.
| Compound Name | ethyl 8-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2,3-dimethyl-7-prop-2-enylimidazo[1,2-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 69099372 |
| Molecular Formula | C23H36N2O3Si |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | ethyl 8-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2,3-dimethyl-7-prop-2-enylimidazo[1,2-a]pyridine-6-carboxylate |
| SMILES | C=CCc1c(C(=O)OCC)cn2c(C)c(C)nc2c1O[Si](C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C23H36N2O3Si/c1-11-13-18-19(22(26)27-12-2)14-25-17(6)16(5)24-21(25)20(18)28-29(9,10)23(7,8)15(3)4/h11,14-15H,1,12-13H2,2-10H3 |
| InChIKey | FCHOOAWQJOTEMY-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|