C23H21Cl2N7O2 — CID 69099945
3-[2-[(3,4-dichlorophenyl)methylamino]-6-(4-methoxyphenyl)-7-oxopteridin-8-yl]propanimidamide (PubChem CID 69099945) has the molecular formula C23H21Cl2N7O2 and a molecular weight of 498.37 g/mol. Its IUPAC name is 3-[2-[(3,4-dichlorophenyl)methylamino]-6-(4-methoxyphenyl)-7-oxopteridin-8-yl]propanimidamide.
| Compound Name | 3-[2-[(3,4-dichlorophenyl)methylamino]-6-(4-methoxyphenyl)-7-oxopteridin-8-yl]propanimidamide |
|---|---|
| PubChem CID | 69099945 |
| Molecular Formula | C23H21Cl2N7O2 |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 3-[2-[(3,4-dichlorophenyl)methylamino]-6-(4-methoxyphenyl)-7-oxopteridin-8-yl]propanimidamide |
| SMILES | [H]/N=C(\N)CCn1c(=O)c(-c2ccc(OC)cc2)nc2cnc(NCc3ccc(Cl)c(Cl)c3)nc21 |
| InChI | InChI=1S/C23H21Cl2N7O2/c1-34-15-5-3-14(4-6-15)20-22(33)32(9-8-19(26)27)21-18(30-20)12-29-23(31-21)28-11-13-2-7-16(24)17(25)10-13/h2-7,10,12H,8-9,11H2,1H3,(H3,26,27)(H,28,29,31) |
| InChIKey | LTWJWFBXIIYGHI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|