C25H23Cl2N5O2 — CID 89143240
6-[(3,4-dichlorophenyl)methylamino]-4-[2-(ethenylamino)ethyl]-2-(4-methoxyphenyl)pyrido[2,3-b]pyrazin-3-one (PubChem CID 89143240) has the molecular formula C25H23Cl2N5O2 and a molecular weight of 496.40 g/mol. Its IUPAC name is 6-[(3,4-dichlorophenyl)methylamino]-4-[2-(ethenylamino)ethyl]-2-(4-methoxyphenyl)pyrido[2,3-b]pyrazin-3-one.
| Compound Name | 6-[(3,4-dichlorophenyl)methylamino]-4-[2-(ethenylamino)ethyl]-2-(4-methoxyphenyl)pyrido[2,3-b]pyrazin-3-one |
|---|---|
| PubChem CID | 89143240 |
| Molecular Formula | C25H23Cl2N5O2 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 6-[(3,4-dichlorophenyl)methylamino]-4-[2-(ethenylamino)ethyl]-2-(4-methoxyphenyl)pyrido[2,3-b]pyrazin-3-one |
| SMILES | C=CNCCn1c(=O)c(-c2ccc(OC)cc2)nc2ccc(NCc3ccc(Cl)c(Cl)c3)nc21 |
| InChI | InChI=1S/C25H23Cl2N5O2/c1-3-28-12-13-32-24-21(30-23(25(32)33)17-5-7-18(34-2)8-6-17)10-11-22(31-24)29-15-16-4-9-19(26)20(27)14-16/h3-11,14,28H,1,12-13,15H2,2H3,(H,29,31) |
| InChIKey | RVDRFUFACYVGEF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|