C22H35N3O4 — CID 69100028
2-[3-[[2-(4-butoxycarbonylpiperazin-1-yl)ethyl-methylamino]methyl]phenyl]propanoic acid (PubChem CID 69100028) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-[3-[[2-(4-butoxycarbonylpiperazin-1-yl)ethyl-methylamino]methyl]phenyl]propanoic acid.
| Compound Name | 2-[3-[[2-(4-butoxycarbonylpiperazin-1-yl)ethyl-methylamino]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69100028 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 2-[3-[[2-(4-butoxycarbonylpiperazin-1-yl)ethyl-methylamino]methyl]phenyl]propanoic acid |
| SMILES | CCCCOC(=O)N1CCN(CCN(C)Cc2cccc(C(C)C(=O)O)c2)CC1 |
| InChI | InChI=1S/C22H35N3O4/c1-4-5-15-29-22(28)25-13-11-24(12-14-25)10-9-23(3)17-19-7-6-8-20(16-19)18(2)21(26)27/h6-8,16,18H,4-5,9-15,17H2,1-3H3,(H,26,27) |
| InChIKey | KSKXWVWELSFVOV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|