C42H55N5O4 — CID 69101193
(2S)-N-[1-amino-4-[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]-3-oxobutyl]-2-(3,3,3-triphenylpropanoylamino)pentanediamide (PubChem CID 69101193) has the molecular formula C42H55N5O4 and a molecular weight of 693.93 g/mol. Its IUPAC name is (2S)-N-[1-amino-4-[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]-3-oxobutyl]-2-(3,3,3-triphenylpropanoylamino)pentanediamide.
| Compound Name | (2S)-N-[1-amino-4-[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]-3-oxobutyl]-2-(3,3,3-triphenylpropanoylamino)pentanediamide |
|---|---|
| PubChem CID | 69101193 |
| Molecular Formula | C42H55N5O4 |
| Molecular Weight | 693.93 g/mol |
| Exact Mass | 693.43 |
| IUPAC Name | (2S)-N-[1-amino-4-[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]-3-oxobutyl]-2-(3,3,3-triphenylpropanoylamino)pentanediamide |
| SMILES | NC(=O)CC[C@H](NC(=O)CC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)NC(N)CC(=O)C[C@H]1CCCN(CC2CCCCC2)C1 |
| InChI | InChI=1S/C42H55N5O4/c43-38(27-36(48)26-32-16-13-25-47(30-32)29-31-14-5-1-6-15-31)46-41(51)37(23-24-39(44)49)45-40(50)28-42(33-17-7-2-8-18-33,34-19-9-3-10-20-34)35-21-11-4-12-22-35/h2-4,7-12,17-22,31-32,37-38H,1,5-6,13-16,23-30,43H2,(H2,44,49)(H,45,50)(H,46,51)/t32-,37+,38?/m1/s1 |
| InChIKey | ZMSIXNACBYMKKN-LEMJSLAUSA-N |
| XLogP | 5.20 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.93 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|