C23H23FN4O2 — CID 69101495
N-[2-amino-5-(6-fluoro-3-pyridinyl)phenyl]-4-(morpholin-4-ylmethyl)benzamide (PubChem CID 69101495) has the molecular formula C23H23FN4O2 and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[2-amino-5-(6-fluoro-3-pyridinyl)phenyl]-4-(morpholin-4-ylmethyl)benzamide.
| Compound Name | N-[2-amino-5-(6-fluoro-3-pyridinyl)phenyl]-4-(morpholin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 69101495 |
| Molecular Formula | C23H23FN4O2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-[2-amino-5-(6-fluoro-3-pyridinyl)phenyl]-4-(morpholin-4-ylmethyl)benzamide |
| SMILES | Nc1ccc(-c2ccc(F)nc2)cc1NC(=O)c1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C23H23FN4O2/c24-22-8-6-19(14-26-22)18-5-7-20(25)21(13-18)27-23(29)17-3-1-16(2-4-17)15-28-9-11-30-12-10-28/h1-8,13-14H,9-12,15,25H2,(H,27,29) |
| InChIKey | FATJNWFKQMYDGP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|