C23H25N3O2S — CID 4796771
N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-4-(morpholin-4-ylmethyl)benzamide (PubChem CID 4796771) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-4-(morpholin-4-ylmethyl)benzamide.
| Compound Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-4-(morpholin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 4796771 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-4-(morpholin-4-ylmethyl)benzamide |
| SMILES | CCc1ccc(-c2csc(NC(=O)c3ccc(CN4CCOCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C23H25N3O2S/c1-2-17-3-7-19(8-4-17)21-16-29-23(24-21)25-22(27)20-9-5-18(6-10-20)15-26-11-13-28-14-12-26/h3-10,16H,2,11-15H2,1H3,(H,24,25,27) |
| InChIKey | BVXZMIFAKBVDSQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |