C32H41N3O2S2 — CID 129109039
4-(morpholin-4-ylmethyl)-N-[4-[3-[2-[tri(propan-2-yl)-λ4-sulfanyl]ethynyl]phenyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 129109039) has the molecular formula C32H41N3O2S2 and a molecular weight of 563.83 g/mol. Its IUPAC name is 4-(morpholin-4-ylmethyl)-N-[4-[3-[2-[tri(propan-2-yl)-λ4-sulfanyl]ethynyl]phenyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(morpholin-4-ylmethyl)-N-[4-[3-[2-[tri(propan-2-yl)-λ4-sulfanyl]ethynyl]phenyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 129109039 |
| Molecular Formula | C32H41N3O2S2 |
| Molecular Weight | 563.83 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | 4-(morpholin-4-ylmethyl)-N-[4-[3-[2-[tri(propan-2-yl)-λ4-sulfanyl]ethynyl]phenyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CC(C)S(C#Cc1cccc(-c2csc(NC(=O)c3ccc(CN4CCOCC4)cc3)n2)c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C32H41N3O2S2/c1-23(2)39(24(3)4,25(5)6)19-14-26-8-7-9-29(20-26)30-22-38-32(33-30)34-31(36)28-12-10-27(11-13-28)21-35-15-17-37-18-16-35/h7-13,20,22-25H,15-18,21H2,1-6H3,(H,33,34,36) |
| InChIKey | XVAUXJWNJFAXCF-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.83 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|