C34H46N4OSSi — CID 90468143
4-[(4-methylpiperazin-1-yl)methyl]-N-[4-[3-methyl-4-[2-tri(propan-2-yl)silylethynyl]phenyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 90468143) has the molecular formula C34H46N4OSSi and a molecular weight of 586.92 g/mol. Its IUPAC name is 4-[(4-methylpiperazin-1-yl)methyl]-N-[4-[3-methyl-4-[2-tri(propan-2-yl)silylethynyl]phenyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-[(4-methylpiperazin-1-yl)methyl]-N-[4-[3-methyl-4-[2-tri(propan-2-yl)silylethynyl]phenyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 90468143 |
| Molecular Formula | C34H46N4OSSi |
| Molecular Weight | 586.92 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | 4-[(4-methylpiperazin-1-yl)methyl]-N-[4-[3-methyl-4-[2-tri(propan-2-yl)silylethynyl]phenyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | Cc1cc(-c2csc(NC(=O)c3ccc(CN4CCN(C)CC4)cc3)n2)ccc1C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C34H46N4OSSi/c1-24(2)41(25(3)4,26(5)6)20-15-29-13-14-31(21-27(29)7)32-23-40-34(35-32)36-33(39)30-11-9-28(10-12-30)22-38-18-16-37(8)17-19-38/h9-14,21,23-26H,16-19,22H2,1-8H3,(H,35,36,39) |
| InChIKey | CDBWZTXMPQGFDK-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.92 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|