C34H48N4OSSi — CID 123558480
4-[(4-ethylpiperazin-1-yl)methyl]-N-[4-[4-[2-tri(propan-2-yl)silylethynyl]hexa-1,3,5-trien-2-yl]-1,3-thiazol-2-yl]benzamide (PubChem CID 123558480) has the molecular formula C34H48N4OSSi and a molecular weight of 588.94 g/mol. Its IUPAC name is 4-[(4-ethylpiperazin-1-yl)methyl]-N-[4-[4-[2-tri(propan-2-yl)silylethynyl]hexa-1,3,5-trien-2-yl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-[(4-ethylpiperazin-1-yl)methyl]-N-[4-[4-[2-tri(propan-2-yl)silylethynyl]hexa-1,3,5-trien-2-yl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 123558480 |
| Molecular Formula | C34H48N4OSSi |
| Molecular Weight | 588.94 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | 4-[(4-ethylpiperazin-1-yl)methyl]-N-[4-[4-[2-tri(propan-2-yl)silylethynyl]hexa-1,3,5-trien-2-yl]-1,3-thiazol-2-yl]benzamide |
| SMILES | C=CC(C#C[Si](C(C)C)(C(C)C)C(C)C)=CC(=C)c1csc(NC(=O)c2ccc(CN3CCN(CC)CC3)cc2)n1 |
| InChI | InChI=1S/C34H48N4OSSi/c1-10-29(16-21-41(25(3)4,26(5)6)27(7)8)22-28(9)32-24-40-34(35-32)36-33(39)31-14-12-30(13-15-31)23-38-19-17-37(11-2)18-20-38/h10,12-15,22,24-27H,1,9,11,17-20,23H2,2-8H3,(H,35,36,39) |
| InChIKey | DZNMURMMWRYYLG-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.94 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|