C17H21N5O4S2 — CID 150361392
N-[4-(4-ethylpiperazine-1-carbonyl)-1,3-thiazol-2-yl]-4-sulfamoylbenzamide (PubChem CID 150361392) has the molecular formula C17H21N5O4S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazine-1-carbonyl)-1,3-thiazol-2-yl]-4-sulfamoylbenzamide.
| Compound Name | N-[4-(4-ethylpiperazine-1-carbonyl)-1,3-thiazol-2-yl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 150361392 |
| Molecular Formula | C17H21N5O4S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | N-[4-(4-ethylpiperazine-1-carbonyl)-1,3-thiazol-2-yl]-4-sulfamoylbenzamide |
| SMILES | CCN1CCN(C(=O)c2csc(NC(=O)c3ccc(S(N)(=O)=O)cc3)n2)CC1 |
| InChI | InChI=1S/C17H21N5O4S2/c1-2-21-7-9-22(10-8-21)16(24)14-11-27-17(19-14)20-15(23)12-3-5-13(6-4-12)28(18,25)26/h3-6,11H,2,7-10H2,1H3,(H2,18,25,26)(H,19,20,23) |
| InChIKey | GVUAXBIILAVRNB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |