C22H21ClN4O2S — CID 16915047
N-[4-(4-benzylpiperazine-1-carbonyl)-1,3-thiazol-2-yl]-4-chlorobenzamide (PubChem CID 16915047) has the molecular formula C22H21ClN4O2S and a molecular weight of 440.96 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazine-1-carbonyl)-1,3-thiazol-2-yl]-4-chlorobenzamide.
| Compound Name | N-[4-(4-benzylpiperazine-1-carbonyl)-1,3-thiazol-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 16915047 |
| Molecular Formula | C22H21ClN4O2S |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | N-[4-(4-benzylpiperazine-1-carbonyl)-1,3-thiazol-2-yl]-4-chlorobenzamide |
| SMILES | O=C(Nc1nc(C(=O)N2CCN(Cc3ccccc3)CC2)cs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClN4O2S/c23-18-8-6-17(7-9-18)20(28)25-22-24-19(15-30-22)21(29)27-12-10-26(11-13-27)14-16-4-2-1-3-5-16/h1-9,15H,10-14H2,(H,24,25,28) |
| InChIKey | FAIYFLDFYAYYSE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |