C22H22ClN5O3S — CID 163620208
4-benzoyl-N-[[2-[(4-chlorobenzoyl)amino]-1,3-thiazol-4-yl]methyl]piperazin-1-amine oxide (PubChem CID 163620208) has the molecular formula C22H22ClN5O3S and a molecular weight of 471.97 g/mol. Its IUPAC name is 4-benzoyl-N-[[2-[(4-chlorobenzoyl)amino]-1,3-thiazol-4-yl]methyl]piperazin-1-amine oxide.
| Compound Name | 4-benzoyl-N-[[2-[(4-chlorobenzoyl)amino]-1,3-thiazol-4-yl]methyl]piperazin-1-amine oxide |
|---|---|
| PubChem CID | 163620208 |
| Molecular Formula | C22H22ClN5O3S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 4-benzoyl-N-[[2-[(4-chlorobenzoyl)amino]-1,3-thiazol-4-yl]methyl]piperazin-1-amine oxide |
| SMILES | O=C(Nc1nc(C[NH+]([O-])N2CCN(C(=O)c3ccccc3)CC2)cs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22ClN5O3S/c23-18-8-6-16(7-9-18)20(29)25-22-24-19(15-32-22)14-28(31)27-12-10-26(11-13-27)21(30)17-4-2-1-3-5-17/h1-9,15,28H,10-14H2,(H,24,25,29) |
| InChIKey | HNLSQALLNKGDLX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|