C40H30F6N4OS — CID 90468141
N-[4-[3,4-bis[2-[2-(trifluoromethyl)phenyl]ethynyl]phenyl]-1,3-thiazol-2-yl]-4-[(4-methylpiperazin-1-yl)methyl]benzamide (PubChem CID 90468141) has the molecular formula C40H30F6N4OS and a molecular weight of 728.76 g/mol. Its IUPAC name is N-[4-[3,4-bis[2-[2-(trifluoromethyl)phenyl]ethynyl]phenyl]-1,3-thiazol-2-yl]-4-[(4-methylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-[4-[3,4-bis[2-[2-(trifluoromethyl)phenyl]ethynyl]phenyl]-1,3-thiazol-2-yl]-4-[(4-methylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 90468141 |
| Molecular Formula | C40H30F6N4OS |
| Molecular Weight | 728.76 g/mol |
| Exact Mass | 728.20 |
| IUPAC Name | N-[4-[3,4-bis[2-[2-(trifluoromethyl)phenyl]ethynyl]phenyl]-1,3-thiazol-2-yl]-4-[(4-methylpiperazin-1-yl)methyl]benzamide |
| SMILES | CN1CCN(Cc2ccc(C(=O)Nc3nc(-c4ccc(C#Cc5ccccc5C(F)(F)F)c(C#Cc5ccccc5C(F)(F)F)c4)cs3)cc2)CC1 |
| InChI | InChI=1S/C40H30F6N4OS/c1-49-20-22-50(23-21-49)25-27-10-12-31(13-11-27)37(51)48-38-47-36(26-52-38)33-19-15-28(14-16-29-6-2-4-8-34(29)39(41,42)43)32(24-33)18-17-30-7-3-5-9-35(30)40(44,45)46/h2-13,15,19,24,26H,20-23,25H2,1H3,(H,47,48,51) |
| InChIKey | FQBLBBGYPPNPJB-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.76 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|