C15H23ClN4O3S — CID 69104510
(2R)-N-[4-(N,N-dimethyl-N'-methylsulfonylcarbamimidoyl)phenyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 69104510) has the molecular formula C15H23ClN4O3S and a molecular weight of 374.89 g/mol. Its IUPAC name is (2R)-N-[4-(N,N-dimethyl-N'-methylsulfonylcarbamimidoyl)phenyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2R)-N-[4-(N,N-dimethyl-N'-methylsulfonylcarbamimidoyl)phenyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 69104510 |
| Molecular Formula | C15H23ClN4O3S |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | (2R)-N-[4-(N,N-dimethyl-N'-methylsulfonylcarbamimidoyl)phenyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CN(C)C(=NS(C)(=O)=O)c1ccc(NC(=O)[C@H]2CCCN2)cc1.Cl |
| InChI | InChI=1S/C15H22N4O3S.ClH/c1-19(2)14(18-23(3,21)22)11-6-8-12(9-7-11)17-15(20)13-5-4-10-16-13;/h6-9,13,16H,4-5,10H2,1-3H3,(H,17,20);1H/t13-;/m1./s1 |
| InChIKey | PUBNDBRZAJYKQA-BTQNPOSSSA-N |
| XLogP | 1.07 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|