C16H20N2O7 — CID 69107564
4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;1-hydroxypyrrolidine-2,5-dione (PubChem CID 69107564) has the molecular formula C16H20N2O7 and a molecular weight of 352.34 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;1-hydroxypyrrolidine-2,5-dione.
| Compound Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;1-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 69107564 |
| Molecular Formula | C16H20N2O7 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;1-hydroxypyrrolidine-2,5-dione |
| SMILES | O=C(O)C1CCC(CN2C(=O)C=CC2=O)CC1.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C12H15NO4.C4H5NO3/c14-10-5-6-11(15)13(10)7-8-1-3-9(4-2-8)12(16)17;6-3-1-2-4(7)5(3)8/h5-6,8-9H,1-4,7H2,(H,16,17);8H,1-2H2 |
| InChIKey | PIXNYZFPXQTUCO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|