C17H10F3NO6 — CID 69108169
2-[[2-nitro-5-[4-(trifluoromethyl)phenyl]phenyl]methylidene]propanedioic acid (PubChem CID 69108169) has the molecular formula C17H10F3NO6 and a molecular weight of 381.26 g/mol. Its IUPAC name is 2-[[2-nitro-5-[4-(trifluoromethyl)phenyl]phenyl]methylidene]propanedioic acid.
| Compound Name | 2-[[2-nitro-5-[4-(trifluoromethyl)phenyl]phenyl]methylidene]propanedioic acid |
|---|---|
| PubChem CID | 69108169 |
| Molecular Formula | C17H10F3NO6 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 2-[[2-nitro-5-[4-(trifluoromethyl)phenyl]phenyl]methylidene]propanedioic acid |
| SMILES | O=C(O)C(=Cc1cc(-c2ccc(C(F)(F)F)cc2)ccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C17H10F3NO6/c18-17(19,20)12-4-1-9(2-5-12)10-3-6-14(21(26)27)11(7-10)8-13(15(22)23)16(24)25/h1-8H,(H,22,23)(H,24,25) |
| InChIKey | XVCDFZYXYQYTOO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|