C16H12F3NO2 — CID 69108604
1-[[2-(trifluoromethyl)phenyl]methyl]-7,7a-dihydroindole-2,3-dione (PubChem CID 69108604) has the molecular formula C16H12F3NO2 and a molecular weight of 307.27 g/mol. Its IUPAC name is 1-[[2-(trifluoromethyl)phenyl]methyl]-7,7a-dihydroindole-2,3-dione.
| Compound Name | 1-[[2-(trifluoromethyl)phenyl]methyl]-7,7a-dihydroindole-2,3-dione |
|---|---|
| PubChem CID | 69108604 |
| Molecular Formula | C16H12F3NO2 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 1-[[2-(trifluoromethyl)phenyl]methyl]-7,7a-dihydroindole-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2ccccc2C(F)(F)F)C2CC=CC=C12 |
| InChI | InChI=1S/C16H12F3NO2/c17-16(18,19)12-7-3-1-5-10(12)9-20-13-8-4-2-6-11(13)14(21)15(20)22/h1-7,13H,8-9H2 |
| InChIKey | YDORHHASHAYRFU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|