C10H15NO2 — CID 69110219
ethyl 3-(1-methylpyrrol-2-yl)propanoate (PubChem CID 69110219) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is ethyl 3-(1-methylpyrrol-2-yl)propanoate.
| Compound Name | ethyl 3-(1-methylpyrrol-2-yl)propanoate |
|---|---|
| PubChem CID | 69110219 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | ethyl 3-(1-methylpyrrol-2-yl)propanoate |
| SMILES | CCOC(=O)CCc1cccn1C |
| InChI | InChI=1S/C10H15NO2/c1-3-13-10(12)7-6-9-5-4-8-11(9)2/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | KMNAIAVULVTTJS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |