C39H55N5O8Si — CID 69111286
[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[4-(dimethylaminomethylideneamino)-2-oxopyrimidin-1-yl]-4-hydroxy-4-methyloxolan-3-yl] 2-(butoxycarbonylamino)-3-methylbutanoate (PubChem CID 69111286) has the molecular formula C39H55N5O8Si and a molecular weight of 749.98 g/mol. Its IUPAC name is [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[4-(dimethylaminomethylideneamino)-2-oxopyrimidin-1-yl]-4-hydroxy-4-methyloxolan-3-yl] 2-(butoxycarbonylamino)-3-methylbutanoate.
| Compound Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[4-(dimethylaminomethylideneamino)-2-oxopyrimidin-1-yl]-4-hydroxy-4-methyloxolan-3-yl] 2-(butoxycarbonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 69111286 |
| Molecular Formula | C39H55N5O8Si |
| Molecular Weight | 749.98 g/mol |
| Exact Mass | 749.38 |
| IUPAC Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[4-(dimethylaminomethylideneamino)-2-oxopyrimidin-1-yl]-4-hydroxy-4-methyloxolan-3-yl] 2-(butoxycarbonylamino)-3-methylbutanoate |
| SMILES | CCCCOC(=O)NC(C(=O)OC1C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(n2ccc(/N=C/N(C)C)nc2=O)C1(C)O)C(C)C |
| InChI | InChI=1S/C39H55N5O8Si/c1-10-11-24-49-37(47)42-32(27(2)3)34(45)52-33-30(51-35(39(33,7)48)44-23-22-31(41-36(44)46)40-26-43(8)9)25-50-53(38(4,5)6,28-18-14-12-15-19-28)29-20-16-13-17-21-29/h12-23,26-27,30,32-33,35,48H,10-11,24-25H2,1-9H3,(H,42,47)/b40-26+ |
| InChIKey | GSDTXCMUOWYPFO-IHELAITMSA-N |
| XLogP | 4.15 |
| TPSA | 153.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.98 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|