C25H34N2O2S — CID 69112377
N-[2-[4-[4-(2-aminocyclopentyl)phenyl]phenyl]cyclopentyl]propane-2-sulfonamide (PubChem CID 69112377) has the molecular formula C25H34N2O2S and a molecular weight of 426.63 g/mol. Its IUPAC name is N-[2-[4-[4-(2-aminocyclopentyl)phenyl]phenyl]cyclopentyl]propane-2-sulfonamide.
| Compound Name | N-[2-[4-[4-(2-aminocyclopentyl)phenyl]phenyl]cyclopentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 69112377 |
| Molecular Formula | C25H34N2O2S |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-[2-[4-[4-(2-aminocyclopentyl)phenyl]phenyl]cyclopentyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NC1CCCC1c1ccc(-c2ccc(C3CCCC3N)cc2)cc1 |
| InChI | InChI=1S/C25H34N2O2S/c1-17(2)30(28,29)27-25-8-4-6-23(25)21-15-11-19(12-16-21)18-9-13-20(14-10-18)22-5-3-7-24(22)26/h9-17,22-25,27H,3-8,26H2,1-2H3 |
| InChIKey | OFVYMGGIIYNXDW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |