C24H20F3NO4 — CID 69115077
benzyl 2-[[3-methoxy-3-oxo-1-(2,4,5-trifluorophenyl)propyl]amino]benzoate (PubChem CID 69115077) has the molecular formula C24H20F3NO4 and a molecular weight of 443.42 g/mol. Its IUPAC name is benzyl 2-[[3-methoxy-3-oxo-1-(2,4,5-trifluorophenyl)propyl]amino]benzoate.
| Compound Name | benzyl 2-[[3-methoxy-3-oxo-1-(2,4,5-trifluorophenyl)propyl]amino]benzoate |
|---|---|
| PubChem CID | 69115077 |
| Molecular Formula | C24H20F3NO4 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | benzyl 2-[[3-methoxy-3-oxo-1-(2,4,5-trifluorophenyl)propyl]amino]benzoate |
| SMILES | COC(=O)CC(Nc1ccccc1C(=O)OCc1ccccc1)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C24H20F3NO4/c1-31-23(29)13-22(17-11-19(26)20(27)12-18(17)25)28-21-10-6-5-9-16(21)24(30)32-14-15-7-3-2-4-8-15/h2-12,22,28H,13-14H2,1H3 |
| InChIKey | QAMNEGVKACSAOF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|