C22H24F3NO5 — CID 51354787
benzyl (3S)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoate (PubChem CID 51354787) has the molecular formula C22H24F3NO5 and a molecular weight of 439.43 g/mol. Its IUPAC name is benzyl (3S)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoate.
| Compound Name | benzyl (3S)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoate |
|---|---|
| PubChem CID | 51354787 |
| Molecular Formula | C22H24F3NO5 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | benzyl (3S)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)OCc1ccccc1)C(O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C22H24F3NO5/c1-22(2,3)31-21(29)26-18(11-19(27)30-12-13-7-5-4-6-8-13)20(28)14-9-16(24)17(25)10-15(14)23/h4-10,18,20,28H,11-12H2,1-3H3,(H,26,29)/t18-,20?/m0/s1 |
| InChIKey | ZFTFIFCNTXOECS-LROBGIAVSA-N |
| XLogP | 4.16 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|