C37H48N4O8S2 — CID 69116069
4-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl)oxy]acetyl]amino]-2-(4-hydroxyphenyl)acetyl]amino]butanoic acid (PubChem CID 69116069) has the molecular formula C37H48N4O8S2 and a molecular weight of 740.95 g/mol. Its IUPAC name is 4-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl)oxy]acetyl]amino]-2-(4-hydroxyphenyl)acetyl]amino]butanoic acid.
| Compound Name | 4-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl)oxy]acetyl]amino]-2-(4-hydroxyphenyl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 69116069 |
| Molecular Formula | C37H48N4O8S2 |
| Molecular Weight | 740.95 g/mol |
| Exact Mass | 740.29 |
| IUPAC Name | 4-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl)oxy]acetyl]amino]-2-(4-hydroxyphenyl)acetyl]amino]butanoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(SC)c(OCC(=O)N[C@@H](C(=O)NCCCC(=O)O)c3ccc(O)cc3)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C37H48N4O8S2/c1-4-6-19-37(20-7-5-2)25-41(27-12-9-8-10-13-27)29-22-31(50-3)30(23-32(29)51(47,48)40-37)49-24-33(43)39-35(26-15-17-28(42)18-16-26)36(46)38-21-11-14-34(44)45/h8-10,12-13,15-18,22-23,35,40,42H,4-7,11,14,19-21,24-25H2,1-3H3,(H,38,46)(H,39,43)(H,44,45)/t35-/m1/s1 |
| InChIKey | DNERDYOGFNYONH-PGUFJCEWSA-N |
| XLogP | 5.88 |
| TPSA | 174.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.95 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|