C35H46N4O8S3 — CID 87886755
2-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]ethanesulfonic acid (PubChem CID 87886755) has the molecular formula C35H46N4O8S3 and a molecular weight of 746.97 g/mol. Its IUPAC name is 2-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 87886755 |
| Molecular Formula | C35H46N4O8S3 |
| Molecular Weight | 746.97 g/mol |
| Exact Mass | 746.25 |
| IUPAC Name | 2-[[(2R)-2-[[2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl)oxy]acetyl]amino]-2-phenylacetyl]amino]ethanesulfonic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(SC)c(OCC(=O)N[C@@H](C(=O)NCCS(=O)(=O)O)c3ccccc3)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C35H46N4O8S3/c1-4-6-18-35(19-7-5-2)25-39(27-16-12-9-13-17-27)28-22-30(48-3)29(23-31(28)50(45,46)38-35)47-24-32(40)37-33(26-14-10-8-11-15-26)34(41)36-20-21-49(42,43)44/h8-17,22-23,33,38H,4-7,18-21,24-25H2,1-3H3,(H,36,41)(H,37,40)(H,42,43,44)/t33-/m1/s1 |
| InChIKey | SZWVAPOGJJXKGR-MGBGTMOVSA-N |
| XLogP | 5.20 |
| TPSA | 171.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.97 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|