About naphthalen-2-ylmethyl (E)-3-phenylprop-2-enimidothioate;hydrobromide
naphthalen-2-ylmethyl (E)-3-phenylprop-2-enimidothioate;hydrobromide (PubChem CID 69118987) has the molecular formula C20H18BrNS
and a molecular weight of 384.34 g/mol. Its IUPAC name is naphthalen-2-ylmethyl (E)-3-phenylprop-2-enimidothioate;hydrobromide.
Molecular Properties
| Compound Name | naphthalen-2-ylmethyl (E)-3-phenylprop-2-enimidothioate;hydrobromide |
| PubChem CID | 69118987 |
| Molecular Formula | C20H18BrNS |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | naphthalen-2-ylmethyl (E)-3-phenylprop-2-enimidothioate;hydrobromide |
| SMILES | Br.[H]/N=C(\C=C\c1ccccc1)SCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H17NS.BrH/c21-20(13-11-16-6-2-1-3-7-16)22-15-17-10-12-18-8-4-5-9-19(18)14-17;/h1-14,21H,15H2;1H/b13-11+,21-20+; |
| InChIKey | CVNYACAHNUJYSG-WPFUVADGSA-N |
| XLogP | 6.34 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-2-ylmethyl (E)-3-phenylprop-2-enimidothioate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-ylmethyl (E)-3-phenylprop-2-enimidothioate;hydrobromide?
The IUPAC name of naphthalen-2-ylmethyl (E)-3-phenylprop-2-enimidothioate;hydrobromide (CID 69118987) is naphthalen-2-ylmethyl (E)-3-phenylprop-2-enimidothioate;hydrobromide.
What is the SMILES notation for naphthalen-2-ylmethyl (E)-3-phenylprop-2-enimidothioate;hydrobromide?
The canonical SMILES for naphthalen-2-ylmethyl (E)-3-phenylprop-2-enimidothioate;hydrobromide is Br.[H]/N=C(\C=C\c1ccccc1)SCc1ccc2ccccc2c1.
What is the InChIKey of naphthalen-2-ylmethyl (E)-3-phenylprop-2-enimidothioate;hydrobromide?
The InChIKey is CVNYACAHNUJYSG-WPFUVADGSA-N. The full InChI is InChI=1S/C20H17NS.BrH/c21-20(13-11-16-6-2-1-3-7-16)22-15-17-10-12-18-8-4-5-9-19(18)14-17;/h1-14,21H,15H2;1H/b13-11+,21-20+;.
What are the key properties of naphthalen-2-ylmethyl (E)-3-phenylprop-2-enimidothioate;hydrobromide?
naphthalen-2-ylmethyl (E)-3-phenylprop-2-enimidothioate;hydrobromide has a molecular weight of 384.34 g/mol, XLogP of 6.34, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-ylmethyl (E)-3-phenylprop-2-enimidothioate;hydrobromide is sourced from PubChem (CID 69118987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).