C18H26O4 — CID 69119220
6-butoxycarbonyl-2-(2,2-dimethylpropyl)-3-methylbenzoic acid (PubChem CID 69119220) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 6-butoxycarbonyl-2-(2,2-dimethylpropyl)-3-methylbenzoic acid.
| Compound Name | 6-butoxycarbonyl-2-(2,2-dimethylpropyl)-3-methylbenzoic acid |
|---|---|
| PubChem CID | 69119220 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 6-butoxycarbonyl-2-(2,2-dimethylpropyl)-3-methylbenzoic acid |
| SMILES | CCCCOC(=O)c1ccc(C)c(CC(C)(C)C)c1C(=O)O |
| InChI | InChI=1S/C18H26O4/c1-6-7-10-22-17(21)13-9-8-12(2)14(11-18(3,4)5)15(13)16(19)20/h8-9H,6-7,10-11H2,1-5H3,(H,19,20) |
| InChIKey | JBPHGKBUKASHLC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|