C15H19FO4 — CID 69119210
3-(2,2-dimethylpropyl)-6-ethoxycarbonyl-2-fluorobenzoic acid (PubChem CID 69119210) has the molecular formula C15H19FO4 and a molecular weight of 282.31 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-6-ethoxycarbonyl-2-fluorobenzoic acid.
| Compound Name | 3-(2,2-dimethylpropyl)-6-ethoxycarbonyl-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 69119210 |
| Molecular Formula | C15H19FO4 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-6-ethoxycarbonyl-2-fluorobenzoic acid |
| SMILES | CCOC(=O)c1ccc(CC(C)(C)C)c(F)c1C(=O)O |
| InChI | InChI=1S/C15H19FO4/c1-5-20-14(19)10-7-6-9(8-15(2,3)4)12(16)11(10)13(17)18/h6-7H,5,8H2,1-4H3,(H,17,18) |
| InChIKey | NEGFNLIALVBJFI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |