C16H18F3N3O5 — CID 69119857
methyl 2-acetamido-5-[2-(ethoxycarbonylhydrazinylidene)ethyl]-4-(trifluoromethyl)benzoate (PubChem CID 69119857) has the molecular formula C16H18F3N3O5 and a molecular weight of 389.33 g/mol. Its IUPAC name is methyl 2-acetamido-5-[2-(ethoxycarbonylhydrazinylidene)ethyl]-4-(trifluoromethyl)benzoate.
| Compound Name | methyl 2-acetamido-5-[2-(ethoxycarbonylhydrazinylidene)ethyl]-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 69119857 |
| Molecular Formula | C16H18F3N3O5 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | methyl 2-acetamido-5-[2-(ethoxycarbonylhydrazinylidene)ethyl]-4-(trifluoromethyl)benzoate |
| SMILES | CCOC(=O)NN=CCc1cc(C(=O)OC)c(NC(C)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C16H18F3N3O5/c1-4-27-15(25)22-20-6-5-10-7-11(14(24)26-3)13(21-9(2)23)8-12(10)16(17,18)19/h6-8H,4-5H2,1-3H3,(H,21,23)(H,22,25) |
| InChIKey | PLOQYGYPXBWXOD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|