C20H22ClN3O2S — CID 69120329
N-[3-[(5-chloro-1H-indol-2-yl)sulfonyl]phenyl]-1-methylpiperidin-4-amine (PubChem CID 69120329) has the molecular formula C20H22ClN3O2S and a molecular weight of 403.94 g/mol. Its IUPAC name is N-[3-[(5-chloro-1H-indol-2-yl)sulfonyl]phenyl]-1-methylpiperidin-4-amine.
| Compound Name | N-[3-[(5-chloro-1H-indol-2-yl)sulfonyl]phenyl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 69120329 |
| Molecular Formula | C20H22ClN3O2S |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-[3-[(5-chloro-1H-indol-2-yl)sulfonyl]phenyl]-1-methylpiperidin-4-amine |
| SMILES | CN1CCC(Nc2cccc(S(=O)(=O)c3cc4cc(Cl)ccc4[nH]3)c2)CC1 |
| InChI | InChI=1S/C20H22ClN3O2S/c1-24-9-7-16(8-10-24)22-17-3-2-4-18(13-17)27(25,26)20-12-14-11-15(21)5-6-19(14)23-20/h2-6,11-13,16,22-23H,7-10H2,1H3 |
| InChIKey | CBTYKDJCOPEQQE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |