C16H25N — CID 69121197
(1S,5R)-3-(4-but-2-ynylcyclohexyl)-2-methyl-3-azabicyclo[3.1.0]hexane (PubChem CID 69121197) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is (1S,5R)-3-(4-but-2-ynylcyclohexyl)-2-methyl-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,5R)-3-(4-but-2-ynylcyclohexyl)-2-methyl-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 69121197 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (1S,5R)-3-(4-but-2-ynylcyclohexyl)-2-methyl-3-azabicyclo[3.1.0]hexane |
| SMILES | CC#CCC1CCC(N2C[C@@H]3C[C@@H]3C2C)CC1 |
| InChI | InChI=1S/C16H25N/c1-3-4-5-13-6-8-15(9-7-13)17-11-14-10-16(14)12(17)2/h12-16H,5-11H2,1-2H3/t12?,13?,14-,15?,16+/m0/s1 |
| InChIKey | URFMZNBMTSMBPM-OLNDHWJISA-N |
| XLogP | 3.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|