C12H17N — CID 130683727
3-but-2-ynyl-3-azatricyclo[4.2.1.02,5]nonane (PubChem CID 130683727) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is 3-but-2-ynyl-3-azatricyclo[4.2.1.02,5]nonane.
| Compound Name | 3-but-2-ynyl-3-azatricyclo[4.2.1.02,5]nonane |
|---|---|
| PubChem CID | 130683727 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 3-but-2-ynyl-3-azatricyclo[4.2.1.02,5]nonane |
| SMILES | CC#CCN1CC2C3CCC(C3)C21 |
| InChI | InChI=1S/C12H17N/c1-2-3-6-13-8-11-9-4-5-10(7-9)12(11)13/h9-12H,4-8H2,1H3 |
| InChIKey | UQXBYORKXPAAMG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|