C12H19N — CID 130736615
3-cyclobutyl-3-azatricyclo[4.2.1.02,5]nonane (PubChem CID 130736615) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 3-cyclobutyl-3-azatricyclo[4.2.1.02,5]nonane.
| Compound Name | 3-cyclobutyl-3-azatricyclo[4.2.1.02,5]nonane |
|---|---|
| PubChem CID | 130736615 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 3-cyclobutyl-3-azatricyclo[4.2.1.02,5]nonane |
| SMILES | C1CC(N2CC3C4CCC(C4)C32)C1 |
| InChI | InChI=1S/C12H19N/c1-2-10(3-1)13-7-11-8-4-5-9(6-8)12(11)13/h8-12H,1-7H2 |
| InChIKey | ZLYWFCFAGNTULB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |