About 2-amino-1-(3-azatricyclo[4.2.1.02,5]nonan-3-yl)ethanone
2-amino-1-(3-azatricyclo[4.2.1.02,5]nonan-3-yl)ethanone (PubChem CID 130701739) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-amino-1-(3-azatricyclo[4.2.1.02,5]nonan-3-yl)ethanone.
Analyze 2-amino-1-(3-azatricyclo[4.2.1.02,5]nonan-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(3-azatricyclo[4.2.1.02,5]nonan-3-yl)ethanone?
The IUPAC name of 2-amino-1-(3-azatricyclo[4.2.1.02,5]nonan-3-yl)ethanone (CID 130701739) is 2-amino-1-(3-azatricyclo[4.2.1.02,5]nonan-3-yl)ethanone.
What is the SMILES notation for 2-amino-1-(3-azatricyclo[4.2.1.02,5]nonan-3-yl)ethanone?
The canonical SMILES for 2-amino-1-(3-azatricyclo[4.2.1.02,5]nonan-3-yl)ethanone is NCC(=O)N1CC2C3CCC(C3)C21.
What is the InChIKey of 2-amino-1-(3-azatricyclo[4.2.1.02,5]nonan-3-yl)ethanone?
The InChIKey is NKWJJUGTFCGRQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c11-4-9(13)12-5-8-6-1-2-7(3-6)10(8)12/h6-8,10H,1-5,11H2.
What are the key properties of 2-amino-1-(3-azatricyclo[4.2.1.02,5]nonan-3-yl)ethanone?
2-amino-1-(3-azatricyclo[4.2.1.02,5]nonan-3-yl)ethanone has a molecular weight of 180.25 g/mol, XLogP of 0.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(3-azatricyclo[4.2.1.02,5]nonan-3-yl)ethanone is sourced from PubChem (CID 130701739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).