C25H36Cl2N2O5 — CID 69122461
4-[[(4R,4aS,12bS)-3-(cyclopropylmethyl)-9-hydroxy-4a-methoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]butanoic acid;dihydrochloride (PubChem CID 69122461) has the molecular formula C25H36Cl2N2O5 and a molecular weight of 515.48 g/mol. Its IUPAC name is 4-[[(4R,4aS,12bS)-3-(cyclopropylmethyl)-9-hydroxy-4a-methoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]butanoic acid;dihydrochloride.
| Compound Name | 4-[[(4R,4aS,12bS)-3-(cyclopropylmethyl)-9-hydroxy-4a-methoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]butanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 69122461 |
| Molecular Formula | C25H36Cl2N2O5 |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 4-[[(4R,4aS,12bS)-3-(cyclopropylmethyl)-9-hydroxy-4a-methoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]butanoic acid;dihydrochloride |
| SMILES | CO[C@@]12CCC(NCCCC(=O)O)C3Oc4c(O)ccc5c4[C@@]31CCN(CC1CC1)[C@@H]2C5.Cl.Cl |
| InChI | InChI=1S/C25H34N2O5.2ClH/c1-31-25-9-8-17(26-11-2-3-20(29)30)23-24(25)10-12-27(14-15-4-5-15)19(25)13-16-6-7-18(28)22(32-23)21(16)24;;/h6-7,15,17,19,23,26,28H,2-5,8-14H2,1H3,(H,29,30);2*1H/t17?,19-,23?,24+,25-;;/m1../s1 |
| InChIKey | QTWVCAUGJOMTAL-GAEIFLPGSA-N |
| XLogP | 3.28 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|