C28H28INO2 — CID 69124872
1-[2-[4-[(Z)-4-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]pyrrolidin-2-one (PubChem CID 69124872) has the molecular formula C28H28INO2 and a molecular weight of 537.44 g/mol. Its IUPAC name is 1-[2-[4-[(Z)-4-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[4-[(Z)-4-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 69124872 |
| Molecular Formula | C28H28INO2 |
| Molecular Weight | 537.44 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | 1-[2-[4-[(Z)-4-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCOc1ccc(/C=C(/CCc2ccc(I)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28INO2/c29-26-14-9-22(10-15-26)8-13-25(24-5-2-1-3-6-24)21-23-11-16-27(17-12-23)32-20-19-30-18-4-7-28(30)31/h1-3,5-6,9-12,14-17,21H,4,7-8,13,18-20H2/b25-21- |
| InChIKey | QSOITPWOELUYHM-DAFNUICNSA-N |
| XLogP | 6.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.44 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|