C29H33F3N6O7S — CID 69127876
[1-[3-[[(2R)-2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]benzimidazol-5-yl] N-aminocarbamate;2,2,2-trifluoroacetic acid (PubChem CID 69127876) has the molecular formula C29H33F3N6O7S and a molecular weight of 666.68 g/mol. Its IUPAC name is [1-[3-[[(2R)-2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]benzimidazol-5-yl] N-aminocarbamate;2,2,2-trifluoroacetic acid.
| Compound Name | [1-[3-[[(2R)-2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]benzimidazol-5-yl] N-aminocarbamate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69127876 |
| Molecular Formula | C29H33F3N6O7S |
| Molecular Weight | 666.68 g/mol |
| Exact Mass | 666.21 |
| IUPAC Name | [1-[3-[[(2R)-2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]benzimidazol-5-yl] N-aminocarbamate;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(CCn1cnc2cc(OC(=O)NN)ccc21)NC[C@H](O)c1cccc(NS(=O)(=O)c2ccccc2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H32N6O5S.C2HF3O2/c1-27(2,13-14-33-18-29-23-16-21(11-12-24(23)33)38-26(35)31-28)30-17-25(34)19-7-6-8-20(15-19)32-39(36,37)22-9-4-3-5-10-22;3-2(4,5)1(6)7/h3-12,15-16,18,25,30,32,34H,13-14,17,28H2,1-2H3,(H,31,35);(H,6,7)/t25-;/m0./s1 |
| InChIKey | HNBIGKBQEUJJMH-UQIIZPHYSA-N |
| XLogP | 3.92 |
| TPSA | 197.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.68 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|