C29H34N4O6S — CID 69125966
[1-[3-[[2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]benzimidazol-5-yl] ethyl carbonate (PubChem CID 69125966) has the molecular formula C29H34N4O6S and a molecular weight of 566.68 g/mol. Its IUPAC name is [1-[3-[[2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]benzimidazol-5-yl] ethyl carbonate.
| Compound Name | [1-[3-[[2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]benzimidazol-5-yl] ethyl carbonate |
|---|---|
| PubChem CID | 69125966 |
| Molecular Formula | C29H34N4O6S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | [1-[3-[[2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]benzimidazol-5-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc2c(c1)ncn2CCC(C)(C)NCC(O)c1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C29H34N4O6S/c1-4-38-28(35)39-23-13-14-26-25(18-23)30-20-33(26)16-15-29(2,3)31-19-27(34)21-9-8-10-22(17-21)32-40(36,37)24-11-6-5-7-12-24/h5-14,17-18,20,27,31-32,34H,4,15-16,19H2,1-3H3 |
| InChIKey | HNFXFINIGXQBMX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|