C27H29ClN4O5S — CID 91339235
[3-[3-[[2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]-6-chlorobenzimidazol-5-yl] formate (PubChem CID 91339235) has the molecular formula C27H29ClN4O5S and a molecular weight of 557.07 g/mol. Its IUPAC name is [3-[3-[[2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]-6-chlorobenzimidazol-5-yl] formate.
| Compound Name | [3-[3-[[2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]-6-chlorobenzimidazol-5-yl] formate |
|---|---|
| PubChem CID | 91339235 |
| Molecular Formula | C27H29ClN4O5S |
| Molecular Weight | 557.07 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | [3-[3-[[2-[3-(benzenesulfonamido)phenyl]-2-hydroxyethyl]amino]-3-methylbutyl]-6-chlorobenzimidazol-5-yl] formate |
| SMILES | CC(C)(CCn1cnc2cc(Cl)c(OC=O)cc21)NCC(O)c1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H29ClN4O5S/c1-27(2,11-12-32-17-29-23-14-22(28)26(37-18-33)15-24(23)32)30-16-25(34)19-7-6-8-20(13-19)31-38(35,36)21-9-4-3-5-10-21/h3-10,13-15,17-18,25,30-31,34H,11-12,16H2,1-2H3 |
| InChIKey | OVFCFDXLOCDYBI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.07 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|