C9H13N — CID 6913
2,4,6-trimethylaniline (PubChem CID 6913) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 2,4,6-trimethylaniline.
| Compound Name | 2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 6913 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(N)c(C)c1 |
| InChI | InChI=1S/C9H13N/c1-6-4-7(2)9(10)8(3)5-6/h4-5H,10H2,1-3H3 |
| InChIKey | KWVPRPSXBZNOHS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|