C10H21N3O3 — CID 69131511
[4-amino-2-(aminomethyl)pyrrolidin-1-yl] tert-butyl carbonate (PubChem CID 69131511) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is [4-amino-2-(aminomethyl)pyrrolidin-1-yl] tert-butyl carbonate.
| Compound Name | [4-amino-2-(aminomethyl)pyrrolidin-1-yl] tert-butyl carbonate |
|---|---|
| PubChem CID | 69131511 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | [4-amino-2-(aminomethyl)pyrrolidin-1-yl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)ON1CC(N)CC1CN |
| InChI | InChI=1S/C10H21N3O3/c1-10(2,3)15-9(14)16-13-6-7(12)4-8(13)5-11/h7-8H,4-6,11-12H2,1-3H3 |
| InChIKey | RVPIQVRWXGXMPJ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |